Advertisements
Advertisements
Question
How are ketones classified?
Advertisements
Solution
On the basis of types of alkyl groups attached to the carbonyl carbon,
ketones are classified as
Simple or symmetrical ketones: The ketones in which both alkyl groups attached to the carbonyl carbon are identical are called simple ketones (R =R’).
Example:
Acetone
Mixed or unsymmetrical ketones: The ketones in which the two alkyl groups attached to the carbonyl carbon are different are called mixed ketones (R ≠ R’).
Ethyl methyl ketone
APPEARS IN
RELATED QUESTIONS
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Write the structure of 3-methyl butanal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Write two uses of formaldehyde
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
CH3CH(OCH3)CHO is called:
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
Write the IUPAC name for the following organic compound:
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
is
IUPAC name of following compound is:
The IUPAC name of neopentane is
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Convert the following:
Bromobenzene to benzoic acid
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone
