Advertisements
Advertisements
Question
Give IUPAC name of :
Advertisements
Solution
IUPAC name :
2-methyl -1-butanal
APPEARS IN
RELATED QUESTIONS
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Write the structure of 3-methyl butanal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write two uses of formaldehyde
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give IUPAC names of the following compound:
Prop-2-enal is called ____________.
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
The correct IUPAC name of the following compound is:
The IUPAC name of neopentane is
What is the IUPAC name of the following compound?
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Write IUPAC name of the following compound:
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the structure of the following compound.
Di-sec. butyl ketone
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
