Advertisements
Advertisements
प्रश्न
Give IUPAC name of :
Advertisements
उत्तर
IUPAC name :
2-methyl -1-butanal
APPEARS IN
संबंधित प्रश्न
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compound according to IUPAC system of nomenclature:
CH3CH=CHCHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
IUPAC name of CH3CHO is ____________.
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
Prop-2-enal is called ____________.
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Give the IUPAC name of the following compound.
CH3 − CH = CH − CHO
Write IUPAC names of the following structures.
Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
The IUPAC name of neopentane is
What is the IUPAC name of the following compound?
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Write IUPAC name of the following compound:
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
