Advertisements
Advertisements
प्रश्न
Give IUPAC name of :

Advertisements
उत्तर
IUPAC name :

2-methyl -1-butanal
APPEARS IN
संबंधित प्रश्न
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Write the structure of 3-methyl butanal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write two uses of formaldehyde
Give simple chemical tests to distinguish between the following pairs of compounds:
Butanal and Butan-2-one
The following compound is called:

CH3CH(OCH3)CHO is called:
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC name of the following compound.
CH3 − CH = CH − CHO
Write IUPAC names of the following structures.

Arrange the following in decreasing order of their acidic strength and give reason for your answer.
\[\ce{CH3CH2OH, CH3COOH, ClCH2COOH, FCH2COOH, C6H5CH2COOH}\]
Write the IUPAC name for the following organic compound:

Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
The correct IUPAC name of the following compound is:

What is the IUPAC name of the following compound?

Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Write IUPAC name of the following compound:

What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
