Advertisements
Advertisements
प्रश्न
Give IUPAC name of :
Advertisements
उत्तर
IUPAC name :
2-methyl -1-butanal
APPEARS IN
संबंधित प्रश्न
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
OHCC6H4CHO-p
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Write two uses of formaldehyde
IUPAC name of CH3CHO is ____________.
Give IUPAC names of the following compound:
Prop-2-enal is called ____________.
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
is
The correct IUPAC name of the following compound is:
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms, write the formula for the following:
Pentaamminenitrito-N-Cobalt (III)
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
Convert the following:
Bromobenzene to benzoic acid
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
