Advertisements
Advertisements
प्रश्न
Write two uses of formaldehyde
Advertisements
उत्तर
Uses of formaldehyde:
a) Formalin (40% solution of formaldehyde) is used as preservative for biological specimens
b) Formaldehyde is used for silvering mirror.
c) Formaldehyde is used for the production of several plastic and resins, bakelite
and binders in plywood.
APPEARS IN
संबंधित प्रश्न
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
CH3CH(OCH3)CHO is called:
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Write IUPAC names of the following structures.
The correct IUPAC name for the given molecule should be
\[\begin{array}{cc}
\ce{H3C - \overset{H}{C} - \overset{H2}{C} - \overset{H}{C} - OH}\\
\phantom{.}|\phantom{.........}|\phantom{}\\
\phantom{...}\ce{CH3}\phantom{......}\ce{CH3}\phantom{}
\end{array}\]
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
The IUPAC name of neopentane is
Using IUPAC norms, write the formula for the following:
Pentaamminenitrito-N-Cobalt (III)
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Convert the following:
Bromobenzene to benzoic acid
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
