Advertisements
Advertisements
प्रश्न
Write two uses of formaldehyde
Advertisements
उत्तर
Uses of formaldehyde:
a) Formalin (40% solution of formaldehyde) is used as preservative for biological specimens
b) Formaldehyde is used for silvering mirror.
c) Formaldehyde is used for the production of several plastic and resins, bakelite
and binders in plywood.
APPEARS IN
संबंधित प्रश्न
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Give IUPAC name of :
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
Give IUPAC names of the following compound:
CH3CH(OCH3)CHO is called:
Prop-2-enal is called ____________.
Give the IUPAC name of the following compound.
CH3 − CH = CH − CHO
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
The correct IUPAC name for the given molecule should be
\[\begin{array}{cc}
\ce{H3C - \overset{H}{C} - \overset{H2}{C} - \overset{H}{C} - OH}\\
\phantom{.}|\phantom{.........}|\phantom{}\\
\phantom{...}\ce{CH3}\phantom{......}\ce{CH3}\phantom{}
\end{array}\]
Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Write the IUPAC name of the following complex:
K2[PdCl4]
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
