Advertisements
Advertisements
Question
Write two uses of formaldehyde
Advertisements
Solution
Uses of formaldehyde:
a) Formalin (40% solution of formaldehyde) is used as preservative for biological specimens
b) Formaldehyde is used for silvering mirror.
c) Formaldehyde is used for the production of several plastic and resins, bakelite
and binders in plywood.
APPEARS IN
RELATED QUESTIONS
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Give simple chemical tests to distinguish between the following pairs of compounds:
Butanal and Butan-2-one
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
What is the IUPAC name of the following compound?
Write the IUPAC name of the following complex:
K2[PdCl4]
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
Convert the following:
Bromobenzene to benzoic acid
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
