Advertisements
Advertisements
प्रश्न
Write two uses of formaldehyde
Advertisements
उत्तर
Uses of formaldehyde:
a) Formalin (40% solution of formaldehyde) is used as preservative for biological specimens
b) Formaldehyde is used for silvering mirror.
c) Formaldehyde is used for the production of several plastic and resins, bakelite
and binders in plywood.
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
The following compound is called:
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
Give the IUPAC name of the following compound.
CH3 − CH = CH − CHO
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
The correct IUPAC name of the following compound is:
IUPAC name of following compound is:
The IUPAC name of neopentane is
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
Convert the following:
Bromobenzene to benzoic acid
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone
