Advertisements
Advertisements
प्रश्न
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Advertisements
उत्तर
IUPAC name: Diphenylmethanone
Common name: Benzophenone
APPEARS IN
संबंधित प्रश्न
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write two uses of formaldehyde
Give simple chemical tests to distinguish between the following pairs of compounds:
Butanal and Butan-2-one
IUPAC name of CH3CHO is ____________.
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
CH3CH(OCH3)CHO is called:
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the IUPAC name of the following complex:
K2[PdCl4]
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
