Advertisements
Advertisements
प्रश्न
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Advertisements
उत्तर
IUPAC name: Cyclopentane carbaldehyde
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Name the following compound according to IUPAC system of nomenclature:
CH3CH=CHCHO
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write two uses of formaldehyde
Give simple chemical tests to distinguish between the following pairs of compounds:
Butanal and Butan-2-one
IUPAC name of CH3CHO is ____________.
Prop-2-enal is called ____________.
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
Write the IUPAC name for the following organic compound:
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
The IUPAC name of neopentane is
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Using IUPAC norms, write the formula for the following:
Pentaamminenitrito-N-Cobalt (III)
Write the structure of the following compound:
Di-sec. butyl ketone
