Advertisements
Advertisements
प्रश्न
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Advertisements
उत्तर
\[\ce{\underset{Ethylbromide}{C2H5Br} + \underset{Sodium methoxide}{NaOCH3} ->[Δ] \underset{Ethyl methyl ether}{C2H5 - O - CH3} + NaBr}\]
APPEARS IN
संबंधित प्रश्न
Write the structure of 3-methyl butanal
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Give IUPAC name of :
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
Write IUPAC names of the following structures.
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
The correct IUPAC name for the given molecule should be
\[\begin{array}{cc}
\ce{H3C - \overset{H}{C} - \overset{H2}{C} - \overset{H}{C} - OH}\\
\phantom{.}|\phantom{.........}|\phantom{}\\
\phantom{...}\ce{CH3}\phantom{......}\ce{CH3}\phantom{}
\end{array}\]
The correct IUPAC name of the following compound is:
IUPAC name of following compound is:
The IUPAC name of neopentane is
What is the IUPAC name of the following compound?
Write IUPAC name of the following compound:
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Convert the following:
Bromobenzene to benzoic acid
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
Write the structure of the following compound:
Di-sec. butyl ketone
