Advertisements
Advertisements
प्रश्न
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Advertisements
उत्तर
\[\ce{\underset{Ethylbromide}{C2H5Br} + \underset{Sodium methoxide}{NaOCH3} ->[Δ] \underset{Ethyl methyl ether}{C2H5 - O - CH3} + NaBr}\]
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Give IUPAC name of :
Give simple chemical tests to distinguish between the following pairs of compounds:
Butanal and Butan-2-one
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give IUPAC names of the following compound:
Prop-2-enal is called ____________.
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
is
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms, write the formula for the following:
Pentaamminenitrito-N-Cobalt (III)
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone
