Advertisements
Advertisements
प्रश्न
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Advertisements
उत्तर
\[\ce{\underset{Ethylbromide}{C2H5Br} + \underset{Sodium methoxide}{NaOCH3} ->[Δ] \underset{Ethyl methyl ether}{C2H5 - O - CH3} + NaBr}\]
APPEARS IN
संबंधित प्रश्न
Write the structure of 3-methyl butanal
Name the following compound according to IUPAC system of nomenclature:
CH3CH=CHCHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Give IUPAC name of :
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give IUPAC names of the following compound:
The following compound is called:
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Write the IUPAC name for the following organic compound:
What is the IUPAC name of the following compound?
Write the IUPAC name of the following complex:
K2[PdCl4]
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Predict the products (name and structure) in the following reaction:
\[\ce{C6H5 - CH2 - CH3 ->[alk. KMnO4][\Delta]}\] ?
Write the structure of the following compound:
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
