Advertisements
Advertisements
प्रश्न
How are ketones classified?
Advertisements
उत्तर
On the basis of types of alkyl groups attached to the carbonyl carbon,
ketones are classified as
Simple or symmetrical ketones: The ketones in which both alkyl groups attached to the carbonyl carbon are identical are called simple ketones (R =R’).
Example:
Acetone
Mixed or unsymmetrical ketones: The ketones in which the two alkyl groups attached to the carbonyl carbon are different are called mixed ketones (R ≠ R’).
Ethyl methyl ketone
APPEARS IN
संबंधित प्रश्न
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write two uses of formaldehyde
IUPAC name of CH3CHO is ____________.
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
The following compound is called:
Prop-2-enal is called ____________.
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
Give the IUPAC name of the following compound.
CH3 − CH = CH − CHO
Write IUPAC names of the following structures.
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
Write the IUPAC name for the following organic compound:
The correct IUPAC name for the given molecule should be
\[\begin{array}{cc}
\ce{H3C - \overset{H}{C} - \overset{H2}{C} - \overset{H}{C} - OH}\\
\phantom{.}|\phantom{.........}|\phantom{}\\
\phantom{...}\ce{CH3}\phantom{......}\ce{CH3}\phantom{}
\end{array}\]
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
IUPAC name of following compound is:
What is the IUPAC name of the following compound?
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
Write IUPAC name of the following compound:
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Write the structure of the following compound.
Di-sec. butyl ketone
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
