Advertisements
Advertisements
प्रश्न
How are ketones classified?
Advertisements
उत्तर
On the basis of types of alkyl groups attached to the carbonyl carbon,
ketones are classified as
Simple or symmetrical ketones: The ketones in which both alkyl groups attached to the carbonyl carbon are identical are called simple ketones (R =R’).
Example:
Acetone
Mixed or unsymmetrical ketones: The ketones in which the two alkyl groups attached to the carbonyl carbon are different are called mixed ketones (R ≠ R’).
Ethyl methyl ketone
APPEARS IN
संबंधित प्रश्न
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Write two uses of formaldehyde
IUPAC name of CH3CHO is ____________.
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give IUPAC names of the following compound:
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Give the IUPAC names of the following compounds.
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
is
IUPAC name of following compound is:
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec. butyl ketone
