Advertisements
Advertisements
प्रश्न
How are ketones classified?
Advertisements
उत्तर
On the basis of types of alkyl groups attached to the carbonyl carbon,
ketones are classified as
Simple or symmetrical ketones: The ketones in which both alkyl groups attached to the carbonyl carbon are identical are called simple ketones (R =R’).
Example:
Acetone
Mixed or unsymmetrical ketones: The ketones in which the two alkyl groups attached to the carbonyl carbon are different are called mixed ketones (R ≠ R’).
Ethyl methyl ketone
APPEARS IN
संबंधित प्रश्न
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Give IUPAC name of :
Give IUPAC names of the following compound:
O-hydroxy benzyl alcohol when reacted with PCl3 gives the product as ______. (IUPAC name)
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
Arrange the following in decreasing order of their acidic strength and give reason for your answer.
\[\ce{CH3CH2OH, CH3COOH, ClCH2COOH, FCH2COOH, C6H5CH2COOH}\]
Write the IUPAC name for the following organic compound:
The correct IUPAC name for the given molecule should be
\[\begin{array}{cc}
\ce{H3C - \overset{H}{C} - \overset{H2}{C} - \overset{H}{C} - OH}\\
\phantom{.}|\phantom{.........}|\phantom{}\\
\phantom{...}\ce{CH3}\phantom{......}\ce{CH3}\phantom{}
\end{array}\]
Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
The correct IUPAC name of the following compound is:
IUPAC name of following compound is:
Write chemical reactions for the following conversions:
Ethyl bromide to ethyl methyl ether.
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Write the IUPAC name of the following complex:
K2[PdCl4]
Complete the following:
\[\ce{CH3CN ->[1. AlH(i - Bu)2][2. H2O] 'A' ->[H2N-OH][H^+] 'B'}\]
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Convert the following:
Bromobenzene to benzoic acid
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Draw structures of the following derivatives
AcetaldehydedimethylacetalACe
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
