Advertisements
Advertisements
प्रश्न
Write the structures and IUPAC names of the α - methyl butyraldehyde.
Advertisements
उत्तर
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Write the structure of 3-methyl butanal
Write the structure of 2-methylbutanal.
Name the following compound according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3(CH2)5CHO
Give IUPAC name of :
Write two uses of formaldehyde
IUPAC name of CH3CHO is ____________.
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
Prop-2-enal is called ____________.
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Write IUPAC names of the following structures.
Which of the following I.U.P.A.C. name for (CH3)2CH – CH2 – CH2Br is correct?
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
Write the reaction and IUPAC name of the product formed when 2-Methylpropanal (isobutyraldehyde) is treated with ethyl magnesium bromide followed by hydrolysis.
Write the IUPAC name of the following complex:
K2[PdCl4]
Write the IUPAC name of
\[\begin{array}{cc}
\ce{CH3 - CH = C - CH - Br}\\
\phantom{.......}|\phantom{....}|\phantom{.}\\
\phantom{......}\ce{H3C}\phantom{...}\ce{CH3}\phantom{}
\end{array}\]
Convert the following:
Bromobenzene to benzoic acid
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
