English

What is a Soap ? - Chemistry

Advertisements
Advertisements

Question

What is a soap ?

Advertisements

Solution

Soaps:Soaps are sodium or potassium salts of higher acids such as lauric (C11H23COOH) , palmitic acid(C15H31COOH) , stearic acid (C15H31COOH) , oleic acid (C17H33COOH) or linoleic acid (C17H31COOH) .

 

shaalaa.com
  Is there an error in this question or solution?
2016-2017 (July)

RELATED QUESTIONS

Explain cationic detergents.


Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.

(C17H32COO)3C3H5 – Glyceryl oleate


Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.


Why do soaps not work in hard water?


Can you use soaps and synthetic detergents to check the hardness of water?


Explain the mechanism of cleansing action of soaps.


Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide


Write balanced chemical equations for the action of methyl bromide on silver propanoate


How soap is prepared?


What is a soft soap?


What is the difference between bathing soap and washing soaps?


How are transparent soaps manufactured?


What are fillers and what role these fillers play in soap?


Match the soaps given in Column I with items given in Column II.

Column I Column II
(i) Soap chips (a) dried miniature soap bubbles
(ii) Soap granules (b) small broken pieces of soap formed from melted soaps
(iii) Soap powder (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\]
(iv) Scouring soap (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\]

Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Transparent soaps are made by dissolving soaps in ethanol.

Reason: Ethanol makes things invisible.


Assertion: Sodium chloride is added to precipitate soap after saponification.

Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.


Which of the following is not a correct statement?


Green chemistry in day-to-day life is in the use of ______.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×