मराठी
महाराष्ट्र राज्य शिक्षण मंडळएचएससी विज्ञान (सामान्य) इयत्ता १२ वी

What is a Soap ? - Chemistry

Advertisements
Advertisements

प्रश्न

What is a soap ?

Advertisements

उत्तर

Soaps:Soaps are sodium or potassium salts of higher acids such as lauric (C11H23COOH) , palmitic acid(C15H31COOH) , stearic acid (C15H31COOH) , oleic acid (C17H33COOH) or linoleic acid (C17H31COOH) .

 

shaalaa.com
  या प्रश्नात किंवा उत्तरात काही त्रुटी आहे का?
2016-2017 (July)

संबंधित प्रश्‍न

Explain cationic detergents.


Why is bithional added to soap?


Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.

(C15H31COO)3C3H5 – Glyceryl palmitate


Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.

(C17H32COO)3C3H5 – Glyceryl oleate


Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.


Can you use soaps and synthetic detergents to check the hardness of water?


Explain the cleansing action of soaps.


Explain the mechanism of cleansing action of soaps.


Write balanced chemical equations for the action of methyl bromide on silver propanoate


Glycerol is added to soap. It functions ______.


What is a soft soap?


If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?


Why is it safer to use soap from the environmental point of view?


What is the difference between bathing soap and washing soaps?


How are transparent soaps manufactured?


What are fillers and what role these fillers play in soap?


Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Transparent soaps are made by dissolving soaps in ethanol.

Reason: Ethanol makes things invisible.


Assertion: Sodium chloride is added to precipitate soap after saponification.

Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.


Which of the following is not a correct statement?


Green chemistry in day-to-day life is in the use of ______.


Self-cleansing windows are example of the ______.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×