Advertisements
Advertisements
प्रश्न
What is a soap ?
Advertisements
उत्तर
Soaps:Soaps are sodium or potassium salts of higher acids such as lauric (C11H23COOH) , palmitic acid(C15H31COOH) , stearic acid (C15H31COOH) , oleic acid (C17H33COOH) or linoleic acid (C17H31COOH) .
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Why do soaps not work in hard water?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
How soap is prepared?
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
What is a soft soap?
What is the side product of soap industry? Give reactions showing soap formation.
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
