Advertisements
Advertisements
Question
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Advertisements
Solution
| Column I | Column II |
(i) ![]() |
(c) Hair conditioners |
(ii) ![]() |
(d) Toothpaste |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (b) Laundry soap |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (a) Dishwashing powder |
Explanation:
(i) Hair shampoos/conditioners are made up of cationic detergents. These are quaternary ammonium salts of amines with chlorides, bromides or acetates, e.g., cetyltrimethyl ammonium bromide.
(ii) Anionic detergents are used in toothpaste e.g., sodium dodecylbenzene sulphonate. It can be prepared as follows.
\[\ce{\underset{Lauryl alcohol}{CH3(CH2)10CH2OH} ->[H2SO4] \underset{Laury hydrogensulphate}{CH3(CH2)10CH2OSO3H} ->[NaOH(aq)] \underset{(Anionic detergent)}{\underset{Sodium laurylsulphate}{CH3(CH2)10CH2OS\overset{-}{O}\overset{+}{N}a}}}\]

(iii) Laundry soaps contain fillers like sodium rosinate. Sodium silicate, borax and sodium carbonate. Sodium rosinate makes the soap to lather well.
(iv) Dishwashing powder are non-ionic detergents.

APPEARS IN
RELATED QUESTIONS
Explain cationic detergents.
What is a soap ?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Why do soaps not work in hard water?
Can you use soaps and synthetic detergents to check the hardness of water?
How soap is prepared?
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
Why is it safer to use soap from the environmental point of view?
What is the difference between bathing soap and washing soaps?
How are transparent soaps manufactured?
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Which of the following is not a correct statement?
Self-cleansing windows are example of the ______.


