Advertisements
Advertisements
प्रश्न
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Advertisements
उत्तर
| Column I | Column II |
(i) ![]() |
(c) Hair conditioners |
(ii) ![]() |
(d) Toothpaste |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (b) Laundry soap |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (a) Dishwashing powder |
Explanation:
(i) Hair shampoos/conditioners are made up of cationic detergents. These are quaternary ammonium salts of amines with chlorides, bromides or acetates, e.g., cetyltrimethyl ammonium bromide.
(ii) Anionic detergents are used in toothpaste e.g., sodium dodecylbenzene sulphonate. It can be prepared as follows.
\[\ce{\underset{Lauryl alcohol}{CH3(CH2)10CH2OH} ->[H2SO4] \underset{Laury hydrogensulphate}{CH3(CH2)10CH2OSO3H} ->[NaOH(aq)] \underset{(Anionic detergent)}{\underset{Sodium laurylsulphate}{CH3(CH2)10CH2OS\overset{-}{O}\overset{+}{N}a}}}\]

(iii) Laundry soaps contain fillers like sodium rosinate. Sodium silicate, borax and sodium carbonate. Sodium rosinate makes the soap to lather well.
(iv) Dishwashing powder are non-ionic detergents.

APPEARS IN
संबंधित प्रश्न
Why is bithional added to soap?
What is a soap ?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.

Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
How soap is prepared?
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
What is a soft soap?
What is the difference between bathing soap and washing soaps?
How are transparent soaps manufactured?
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Which of the following is not a correct statement?
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.


