Advertisements
Advertisements
प्रश्न
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Advertisements
उत्तर
| Column I | Column II |
(i) ![]() |
(c) Hair conditioners |
(ii) ![]() |
(d) Toothpaste |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (b) Laundry soap |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (a) Dishwashing powder |
Explanation:
(i) Hair shampoos/conditioners are made up of cationic detergents. These are quaternary ammonium salts of amines with chlorides, bromides or acetates, e.g., cetyltrimethyl ammonium bromide.
(ii) Anionic detergents are used in toothpaste e.g., sodium dodecylbenzene sulphonate. It can be prepared as follows.
\[\ce{\underset{Lauryl alcohol}{CH3(CH2)10CH2OH} ->[H2SO4] \underset{Laury hydrogensulphate}{CH3(CH2)10CH2OSO3H} ->[NaOH(aq)] \underset{(Anionic detergent)}{\underset{Sodium laurylsulphate}{CH3(CH2)10CH2OS\overset{-}{O}\overset{+}{N}a}}}\]

(iii) Laundry soaps contain fillers like sodium rosinate. Sodium silicate, borax and sodium carbonate. Sodium rosinate makes the soap to lather well.
(iv) Dishwashing powder are non-ionic detergents.

APPEARS IN
संबंधित प्रश्न
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Why do soaps not work in hard water?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the cleansing action of soaps.
Write balanced chemical equations for the action of methyl bromide on silver propanoate
How soap is prepared?
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
Why is it safer to use soap from the environmental point of view?
What is the side product of soap industry? Give reactions showing soap formation.
What is the difference between bathing soap and washing soaps?
How are transparent soaps manufactured?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Which of the following is not a correct statement?


