Advertisements
Advertisements
Question
Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimised? Classify the detergents according to their chemical nature.
Advertisements
Solution
Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic Detergents: These are sodium salts of sulphonated long-chain alcohols or hydrocarbons. Alkyl hydrogen sulphates formed by treating long-chain alcohols with concentrated sulphuric acid are neutralised with alkali to form anionic detergents. Similarly alkyl benzene sulphonates are obtained by neutralising alkyl benzene sulphonic acids with alkali.
\[\ce{\underset{Lauryl alcohol}{CH3(CH2)10CH2OH} ->[H2SO4] \underset{Lauryl hydrogensulphate}{CH3(CH2)10CH2OSOH} ->[NaOH(aq)] \underset{(Anionic detergent)}{\underset{Sodium laurylsulphate}{CH3(CH2)10CH2OS\overset{_}{O}3\overset{+}{N}a}}}\]

In anionic detergents, the anionic part of the molecule is involved in the cleansing action.
(ii) Cationic detergents: These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
Cetyltrimethyl ammonium bromide
(iii) Non-ionic detergents: These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol.
\[\ce{\underset{Stearic acid}{CH3(CH2)16COOH} + \underset{Polyethleneglycol}{HO(CH2CH2O)nCH2CH2OH} ->[-H2O] CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\]
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.
APPEARS IN
RELATED QUESTIONS
Explain the following terms with suitable examples - Anionic detergents
If water contains dissolved calcium hydrogen carbonate, out of soaps and synthetic detergents which one will you use for cleaning clothes?
Label the hydrophilic and hydrophobic parts in the following compounds.

Label the hydrophilic and hydrophobic parts in the following compounds.
`CH_3(CH_2)_16COO(CH_2CH_2O)_nCH_2CH_2OH`
What type of detergents are used in toothpaste?
What type of detergent are used in toothpastes?
Polyethyleneglycols are used in the preparation of which type of detergents?
Which of the following statements are correct?
(i) Cationic detergents have germicidal properties.
(ii) Bacteria can degrade the detergents containing highly branched chains.
(iii) Some synthetic detergents can give foam even in ice cold water.
(iv) Synthetic detergents are not soaps.
Explain why some times foaming is seen in river water near the place where sewage water is poured after treatment?
Which category of the synthetic detergents is used in toothpaste?
Hair shampoos belong to which class of synthetic detergent?
Dishwashing soaps are synthetic detergents. What is their chemical nature?
How does the branching of hydrocarbon chain of synthetic detergents affect their biodegradability?
Define the following:
Cationic detergents
Explain the following terms with suitable examples Cationic detergents
Explain the following term with suitable example cationic detergents.
Explain the following term with suitable example:
cationic detergents
