Advertisements
Advertisements
प्रश्न
Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimised? Classify the detergents according to their chemical nature.
Advertisements
उत्तर
Synthetic detergents are cleansing agents which have all the properties of soaps, but which actually do not contain any soap. These can be used both in soft and hard water as they given foam even in hard water. Detergents can be classified into three groups according their chemical nature.
(i) Anionic Detergents: These are sodium salts of sulphonated long-chain alcohols or hydrocarbons. Alkyl hydrogen sulphates formed by treating long-chain alcohols with concentrated sulphuric acid are neutralised with alkali to form anionic detergents. Similarly alkyl benzene sulphonates are obtained by neutralising alkyl benzene sulphonic acids with alkali.
\[\ce{\underset{Lauryl alcohol}{CH3(CH2)10CH2OH} ->[H2SO4] \underset{Lauryl hydrogensulphate}{CH3(CH2)10CH2OSOH} ->[NaOH(aq)] \underset{(Anionic detergent)}{\underset{Sodium laurylsulphate}{CH3(CH2)10CH2OS\overset{_}{O}3\overset{+}{N}a}}}\]

In anionic detergents, the anionic part of the molecule is involved in the cleansing action.
(ii) Cationic detergents: These are quaternary ammonium salts of amines with acetates, chlorides or bromides as anions.
Cetyltrimethyl ammonium bromide
(iii) Non-ionic detergents: These do not contain any ion in their constitution, e.g., detergent formed by steric acid and polyethylene glycol.
\[\ce{\underset{Stearic acid}{CH3(CH2)16COOH} + \underset{Polyethleneglycol}{HO(CH2CH2O)nCH2CH2OH} ->[-H2O] CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\]
Pollution by synthetic detergents can be minimized by reducing the branching of hydrocarbon chain or using unbranched hydrocarbons.
APPEARS IN
संबंधित प्रश्न
If water contains dissolved calcium hydrogen carbonate, out of soaps and synthetic detergents which one will you use for cleaning clothes?
What are anionic detergents? Give an example ?
Define the following term with a suitable example:
Cationic detergents
What type of detergents are used in toothpaste?
What type of detergent are used in toothpastes?
Which of the following is an example of liquid dishwashing detergent?
Polyethyleneglycols are used in the preparation of which type of detergents?
Explain why some times foaming is seen in river water near the place where sewage water is poured after treatment?
Hair shampoos belong to which class of synthetic detergent?
Draw the diagram showing micelle formation by the following detergent.
\[\ce{CH3(CH2)10CH2OS\overset{-}{O}3\overset{+}{N}a}\]
Match structures given in Column I with the type of detergents given in Column II.
| Column I | Column II |
| (i) \[\ce{CH3(CH2)16COO(CH2CH2O) nCH2CH2OH}\] | (a) Cationic detergent |
| (ii) \[\ce{C17H35COO- Na+}\] | (b) Anionic detergent |
| (iii) \[\ce{CH3-(CH2)10CH2SO3- Na+}\] | (c) Nonionic detergent |
|
(iv) |
(d) Soap |
Explain the following term with suitable example.
Cationic detergents
Define the following:
Cationic detergents
Explain the following term with suitable examples.
cationic detergents
Explain the following terms with suitable examples Cationic detergents
Explain the following term with suitable example cationic detergents.
Explain the Following Term with Suitable Examples.
Cationic Detergents
Explain the following term with suitable example:
cationic detergents

