Advertisements
Advertisements
Question
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Advertisements
Solution
| Column I | Column II |
| (i) Soap chips | (b) small broken pieces of soap formed from melted soaps |
| (ii) Soap granules | (a) dried miniature soap bubbles |
| (iii) Soap powder | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
| (iv) Scouring soap | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
Explanation:
(i) Soap chips are made by running a thin sheet of melted soap into a cool cylinder and scraping off the soaps in small broken pieces.
(ii) Soap granules are dried miniature soap bubbles.
(iii) Soap powders contain soap powder and builders like sodium carbonate and trisodium phosphate. Builders make the soap act more rapidly.
(iv) Scouring soaps contain soap powder, a scouring agent (abrasive) such as powdered pumice or finely divided sand and builders.
APPEARS IN
RELATED QUESTIONS
Why is bithional added to soap?
What is a soap ?
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.

Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Which of the following enhances leathering property of soap?
Why is it safer to use soap from the environmental point of view?
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Which of the following is not a correct statement?
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.


