Advertisements
Advertisements
प्रश्न
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Advertisements
उत्तर
| Column I | Column II |
| (i) Soap chips | (b) small broken pieces of soap formed from melted soaps |
| (ii) Soap granules | (a) dried miniature soap bubbles |
| (iii) Soap powder | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
| (iv) Scouring soap | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
Explanation:
(i) Soap chips are made by running a thin sheet of melted soap into a cool cylinder and scraping off the soaps in small broken pieces.
(ii) Soap granules are dried miniature soap bubbles.
(iii) Soap powders contain soap powder and builders like sodium carbonate and trisodium phosphate. Builders make the soap act more rapidly.
(iv) Scouring soaps contain soap powder, a scouring agent (abrasive) such as powdered pumice or finely divided sand and builders.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
What is a soap ?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.

Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Write balanced chemical equations for the action of methyl bromide on silver propanoate
How soap is prepared?
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
Why is it safer to use soap from the environmental point of view?
What is the difference between bathing soap and washing soaps?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Which of the following is not a correct statement?


