Advertisements
Advertisements
प्रश्न
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Advertisements
उत्तर
(d) acetal
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compound according to IUPAC system of nomenclature:
(CH3)3CCH2COOH
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Give IUPAC name of :
Write two uses of formaldehyde
Give simple chemical tests to distinguish between the following pairs of compounds:
Butanal and Butan-2-one
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give IUPAC names of the following compound:
Benzophenone can be obtained by:
(i) Benzoyl chloride + Benzene + \[\ce{AlCl3}\]
(ii) Benzoyl chloride + Diphenyl cadmium
(iii) Benzoyl chloride + Phenyl magnesium chloride
(iv) Benzene + Carbon monoxide + \[\ce{ZnCl2}\]
Give the IUPAC names of the following compounds.
Give the IUPAC names of the following compounds.
\[\begin{array}{cc}
\ce{CH3 - CH2 - C - CH2 - CHO}\\
||\phantom{.}\\
\ce{O}\phantom{.}
\end{array}\]
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Arrange the following in decreasing order of their acidic strength and give reason for your answer.
\[\ce{CH3CH2OH, CH3COOH, ClCH2COOH, FCH2COOH, C6H5CH2COOH}\]
The correct IUPAC name for Na[PdBrCl(NO2)(NH3)] is:
is
The correct IUPAC name of the following compound is:
The IUPAC name of neopentane is
What is the IUPAC name of the following compound?
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms, write the formula for the following:
Pentaamminenitrito-N-Cobalt (III)
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Write the structure of the following compound:
Di-sec-butyl ketone
Predict the products (name and structure) in the following reaction:
\[\ce{CH3CH2CN ->[\Delta][dil. HCl]}\] ?
Predict the products (name and structure) in the following reaction:
\[\ce{CH3 - CONH2 ->[\Delta][dil. HCl]}\] ?
Write the structure of the following compound:
Di-sec-butyl ketone
