Advertisements
Advertisements
प्रश्न
Compound having general formula 
is called
(A) diester
(B) acid anhydride
(C) hemiacetal
(D) acetal
Advertisements
उत्तर
(d) acetal
APPEARS IN
संबंधित प्रश्न
How are ketones classified?
Name the following compound according to IUPAC system of nomenclature:
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compound according to IUPAC system of nomenclature:
CH3CH=CHCHO
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
Write the IUPAC name of the following ketone or aldehyde. Wherever possible, give also the common name.
PhCOPh
Write two uses of formaldehyde
IUPAC name of CH3CHO is ____________.
Give IUPAC names of the following compound:
CH3CH2CH2CH(Br)CH(CH3)CH2CHO
Give the IUPAC name of the following compound:
\[\begin{array}{cc}
\phantom{.................}\ce{Br}\phantom{....}\ce{CH3}\phantom{.........}\ce{O}\phantom{...}\\
\phantom{................}|\phantom{......}|\phantom{............}||\phantom{..}\\
\ce{CH3 - CH2 - CH2CH - CH - CH2 - C - H}
\end{array}\]
Give IUPAC names of the following compound:
Prop-2-enal is called ____________.
Write IUPAC names of the following structures.
\[\begin{array}{cc}
\ce{CHO}\\
|\phantom{....}\\
\ce{CHO}\\
\end{array}\]
Arrange the following in the increasing order of their property indicated:
Acetaldehyde, Acetone, Methyl tert butyl ketone (reactivity towards NH2OH).
Write the IUPAC name for the following organic compound:
The IUPAC name of neopentane is
Write the IUPAC name of the following complex:
[Pt(NH3)6]Cl4
Using IUPAC norms, write the formula for the following:
Pentaamminenitrito-N-Cobalt (III)
Using IUPAC norms write the formula for the following:
Tetrahydroxidozincate (II)
What is IUPAC name of the ketone A, which undergoes iodo form reaction to give \[\ce{CH3CH = C(CH3)COONa}\] and yellow precipitate of \[\ce{CH3}\]?
Write the structure of the following compound:
Di-sec-butyl ketone
Name the following compounds according to the IUPAC system of nomenclature:
\[\ce{(CH3)3CCH2COOH}\]
Write the structure of the following compound.
Di-sec. butyl ketone
Write the structure of the following compound:
Di-sec-butyl ketone
Draw structure of the following derivative.
Acetaldehydedimethylacetal.
Write the structure of the following compound.
Di-sec. butyl ketone
