Advertisements
Advertisements
Question
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Advertisements
Solution
Balance equation is
\[\ce{\underset{\text{styrene}}{C6H5CH} = CH2 + HBr ->[Peroxide] C6H5CH2 - CH2Br }\]
APPEARS IN
RELATED QUESTIONS
Why is bithional added to soap?
What is a soap ?
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Why do soaps not work in hard water?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
Why is it safer to use soap from the environmental point of view?
What is the side product of soap industry? Give reactions showing soap formation.
What is the difference between bathing soap and washing soaps?
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Which of the following is not a correct statement?
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
