Advertisements
Advertisements
Question
Why is it safer to use soap from the environmental point of view?
Advertisements
Solution
Soaps are biodegradable. The detergents are quite stable and are non-biodegradable because of branching in hydrocarbon chain hence cause water pollution. Therefore, it is safer to use soap from the environmental point of view.
APPEARS IN
RELATED QUESTIONS
Explain cationic detergents.
Why is bithional added to soap?
What is a soap ?
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
How soap is prepared?
Which of the following enhances leathering property of soap?
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
How are transparent soaps manufactured?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
