Advertisements
Advertisements
Question
How are transparent soaps manufactured?
Advertisements
Solution
Transparent soaps are prepared by dissolving the soap in ethanol and then evaporating the excess solvent.
APPEARS IN
RELATED QUESTIONS
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Explain the cleansing action of soaps.
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Which of the following enhances leathering property of soap?
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
Why is it safer to use soap from the environmental point of view?
What is the side product of soap industry? Give reactions showing soap formation.
What is the difference between bathing soap and washing soaps?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Which of the following is not a correct statement?
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
