Advertisements
Advertisements
प्रश्न
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
पर्याय
Assertion and reason both are correct statement but reason does not explain assertion.
Assertion and reason both are correct and reason explains the assertion.
Both assertion and reason are wrong statement.
Assertion is correct statement reason is wrong statement.
Assertion is wrong statement reason is correct statement.
Advertisements
उत्तर
Assertion is correct statement reason is wrong statement.
Explanation:
Ethanol removes air and moisture which scatter light.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
What is the side product of soap industry? Give reactions showing soap formation.
What is the difference between bathing soap and washing soaps?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Which of the following is not a correct statement?
Self-cleansing windows are example of the ______.
