Advertisements
Advertisements
प्रश्न
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
विकल्प
Assertion and reason both are correct statement but reason does not explain assertion.
Assertion and reason both are correct and reason explains the assertion.
Both assertion and reason are wrong statement.
Assertion is correct statement reason is wrong statement.
Assertion is wrong statement reason is correct statement.
Advertisements
उत्तर
Assertion is correct statement reason is wrong statement.
Explanation:
Ethanol removes air and moisture which scatter light.
APPEARS IN
संबंधित प्रश्न
What is a soap ?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Why do soaps not work in hard water?
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Which of the following enhances leathering property of soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
What is the side product of soap industry? Give reactions showing soap formation.
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
