मराठी
कर्नाटक बोर्ड पी.यू.सी.पीयूसी विज्ञान 2nd PUC Class 12

Why Do Soaps Not Work in Hard Water? - Chemistry

Advertisements
Advertisements

प्रश्न

Why do soaps not work in hard water?

Advertisements

उत्तर

Soaps are sodium or potassium salts of long-chain fatty acids. Hard water contains calcium and magnesium ions. When soaps are dissolved in hard water, these ions displace sodium or potassium from their salts and form insoluble calcium or magnesium salts of fatty acids. These insoluble salts separate as scum.

`2C_17H_35COONa + CaCl -> 2NaCl + (C_17H_35COO)_2Ca`

          Soap                                                        Insiluable calcium Stearate(Soap)

 

This is the reason why soaps do not work in hard water.

shaalaa.com
  या प्रश्नात किंवा उत्तरात काही त्रुटी आहे का?

संबंधित प्रश्‍न

Explain cationic detergents.


Why is bithional added to soap?


Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.

(C15H31COO)3C3H5 – Glyceryl palmitate


Explain the mechanism of cleansing action of soaps.


Glycerol is added to soap. It functions ______.


If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?


Why is it safer to use soap from the environmental point of view?


What is the side product of soap industry? Give reactions showing soap formation.


What is the difference between bathing soap and washing soaps?


How are transparent soaps manufactured?


What are fillers and what role these fillers play in soap?


Match the soaps given in Column I with items given in Column II.

Column I Column II
(i) Soap chips (a) dried miniature soap bubbles
(ii) Soap granules (b) small broken pieces of soap formed from melted soaps
(iii) Soap powder (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\]
(iv) Scouring soap (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\]

Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Sodium chloride is added to precipitate soap after saponification.

Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.


Which of the following is not a correct statement?


Green chemistry in day-to-day life is in the use of ______.


Self-cleansing windows are example of the ______.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×