Advertisements
Advertisements
प्रश्न
Why is bithional added to soap?
Advertisements
उत्तर १
Bithional is an antiseptic so it is added to soaps to reduce odours producing bacterial decomposition of organic matter on the skin.
उत्तर २
Bithional is a bacteriostatic agent which is added to impart antibacterial properties to soap.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Why do soaps not work in hard water?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of methyl bromide on silver propanoate
How soap is prepared?
How are transparent soaps manufactured?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
