Advertisements
Advertisements
प्रश्न
What is the difference between bathing soap and washing soaps?
Advertisements
उत्तर
Bathing soaps are potassium salts of long-chain fatty acids. They are usually soft and also free from unused alkali. While washing soaps are sodium salts of long-chain fatty acids. They are usually hard and also contain some residual alkali.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
What is a soap ?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
How soap is prepared?
Which of the following enhances leathering property of soap?
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Which of the following is not a correct statement?
Green chemistry in day-to-day life is in the use of ______.
