मराठी
कर्नाटक बोर्ड पी.यू.सी.पीयूसी विज्ञान 2nd PUC Class 12

Label the hydrophilic and hydrophobic parts in the following compounds: CH3(CH2)16COO(CH2CH2O)nCH2CH2OH - Chemistry

Advertisements
Advertisements

प्रश्न

Label the hydrophilic and hydrophobic parts in the following compounds.

`CH_3(CH_2)_16COO(CH_2CH_2O)_nCH_2CH_2OH`

Advertisements

उत्तर

shaalaa.com
  या प्रश्नात किंवा उत्तरात काही त्रुटी आहे का?

संबंधित प्रश्‍न

Explain the following term with a suitable example:

Cationic detergents


What are biodegradable and non-biodegradable detergents? Give one example of each.


Label the hydrophilic and hydrophobic parts in the following compounds.

CH3(CH2)10CH2OSO3 Na+


Label the hydrophilic and hydrophobic parts in the following compounds.


Define the following term with a suitable example: 
Cationic detergents


Which of the following is an example of liquid dishwashing detergent?


Polyethyleneglycols are used in the preparation of which type of detergents?


Hair shampoos belong to which class of synthetic detergent?


Draw the diagram showing micelle formation by the following detergent.

\[\ce{CH3(CH2)10CH2OS\overset{-}{O}3\overset{+}{N}a}\]


How does the branching of hydrocarbon chain of synthetic detergents affect their biodegradability?


Synthetic detergents have advantage over usual soaps as far as cleansing power is concerned. But use of synthetic detergents over a long time creates environmental pollution. How can the pollution caused by synthetic detergents be minimised? Classify the detergents according to their chemical nature.


Explain the following term with suitable example.

Cationic detergents


Define the following:

Cationic detergents


Explain the following term with suitable examples.

Cationic detergents


Explain the following term with suitable example cationic detergents.


Explain the Following Term with Suitable Examples.

Cationic Detergents


Explain the following term with suitable example.

Cationic detergents


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×