मराठी
कर्नाटक बोर्ड पी.यू.सी.पीयूसी विज्ञान 2nd PUC Class 12

Following Type of Nom-ionic Detergents Are Present in Liquid Detergents, Emulsifying Agents and Wetting Agents. Label the Hydrophilic and Hydrophobic Parts in the Molecule. Identify the Functional Group (S) Present in the Molecule. - Chemistry

Advertisements
Advertisements

प्रश्न

Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.

Advertisements

उत्तर

Functional groups present in the molecule are:

(i) Ether, and

(ii) primary alcoholic group

shaalaa.com
  या प्रश्नात किंवा उत्तरात काही त्रुटी आहे का?

संबंधित प्रश्‍न

Explain cationic detergents.


Why is bithional added to soap?


What is a soap ?


Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.

(C15H31COO)3C3H5 – Glyceryl palmitate


Why do soaps not work in hard water?


Can you use soaps and synthetic detergents to check the hardness of water?


Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide


Write balanced chemical equations for the action of methyl bromide on silver propanoate


How soap is prepared?


Which of the following enhances leathering property of soap?


Glycerol is added to soap. It functions ______.


What is a soft soap?


What is the side product of soap industry? Give reactions showing soap formation.


What is the difference between bathing soap and washing soaps?


How are transparent soaps manufactured?


What are fillers and what role these fillers play in soap?


Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Transparent soaps are made by dissolving soaps in ethanol.

Reason: Ethanol makes things invisible.


Assertion: Sodium chloride is added to precipitate soap after saponification.

Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×