मराठी
महाराष्ट्र राज्य शिक्षण मंडळएचएससी विज्ञान (सामान्य) इयत्ता १२ वी

Write Balanced Chemical Equations for the Action of Methyl Bromide on Silver Propanoate - Chemistry

Advertisements
Advertisements

प्रश्न

Write balanced chemical equations for the action of methyl bromide on silver propanoate

Advertisements

उत्तर

shaalaa.com
  या प्रश्नात किंवा उत्तरात काही त्रुटी आहे का?
2012-2013 (March)

APPEARS IN

संबंधित प्रश्‍न

Why is bithional added to soap?


Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.

(C15H31COO)3C3H5 – Glyceryl palmitate


Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.

(C17H32COO)3C3H5 – Glyceryl oleate


Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.


Why do soaps not work in hard water?


Can you use soaps and synthetic detergents to check the hardness of water?


Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide


How soap is prepared?


Which of the following enhances leathering property of soap?


What is a soft soap?


If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?


What is the side product of soap industry? Give reactions showing soap formation.


How are transparent soaps manufactured?


Match the soaps given in Column I with items given in Column II.

Column I Column II
(i) Soap chips (a) dried miniature soap bubbles
(ii) Soap granules (b) small broken pieces of soap formed from melted soaps
(iii) Soap powder (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\]
(iv) Scouring soap (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\]

Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Transparent soaps are made by dissolving soaps in ethanol.

Reason: Ethanol makes things invisible.


Assertion: Sodium chloride is added to precipitate soap after saponification.

Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.


Green chemistry in day-to-day life is in the use of ______.


Self-cleansing windows are example of the ______.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×