हिंदी
कर्नाटक बोर्ड पी.यू.सी.पीयूसी विज्ञान 2nd PUC Class 12

What is the side product of soap industry? Give reactions showing soap formation. - Chemistry

Advertisements
Advertisements

प्रश्न

What is the side product of soap industry? Give reactions showing soap formation.

टिप्पणी लिखिए
Advertisements

उत्तर

Glycerol is obtained as a side product during the formation of soaps.

The process of soap formation is referred as saponification. It is the process that involves the conversion of fat or oil into soap and alcohol by action of heat in the presence of aqueous alkali.

\[\begin{array}{cc}
\ce{O}\phantom{..........................................}\\
||\phantom{..........................................}\\
\phantom{.}\ce{CH2 - O - \underset{}{C} - C17H35}\phantom{..................................}\ce{CH2 - OH}\phantom{.}\\
\phantom{..}|\phantom{..........}\ce{O}\phantom{............................................}|\phantom{..........}\\
|\phantom{..........}||\phantom{.....................................................}\\
\phantom{}\ce{CH - O - C - C17H35 + \underset{hydroxide}{\underset{Sodium}{3NaOH}} -> \underset{sterate}{\underset{Sodium}{3C17H35COONa}} + CH - OH}\phantom{.}\\
\phantom{..}|\phantom{..........}\ce{O}\phantom{............................................}|\phantom{..........}\\
|\phantom{..........}||\phantom{.....................................................}\\
\phantom{.}\ce{\underset{of stearic acid (Fat)}{\underset{Glyceryl ester}{CH2 - O - C - C17H35}}\phantom{...................................}\ce{\underset{(or Glycerine)}{\underset{Glycerol}{CH2 - OH}}}\phantom{}}
\end{array}\]

shaalaa.com
  क्या इस प्रश्न या उत्तर में कोई त्रुटि है?
अध्याय 16: Chemistry In Everyday Life - Multiple Choice Questions (Type - I) [पृष्ठ २३४]

APPEARS IN

एनसीईआरटी एक्झांप्लर Chemistry [English] Class 12
अध्याय 16 Chemistry In Everyday Life
Multiple Choice Questions (Type - I) | Q 60 | पृष्ठ २३४

संबंधित प्रश्न

Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.

(C15H31COO)3C3H5 – Glyceryl palmitate


Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.

(C17H32COO)3C3H5 – Glyceryl oleate


Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.


Why do soaps not work in hard water?


Explain the cleansing action of soaps.


Explain the mechanism of cleansing action of soaps.


Which of the following enhances leathering property of soap?


Glycerol is added to soap. It functions ______.


Why is it safer to use soap from the environmental point of view?


What is the difference between bathing soap and washing soaps?


How are transparent soaps manufactured?


Match the soaps given in Column I with items given in Column II.

Column I Column II
(i) Soap chips (a) dried miniature soap bubbles
(ii) Soap granules (b) small broken pieces of soap formed from melted soaps
(iii) Soap powder (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\]
(iv) Scouring soap (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\]

Match the detergents given in Column I with their uses given in Column II.

Column I Column II
(i)  (a) Dishwashing powder
(ii)  (b) Laundry soap
(iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] (c) Hair conditioners
(iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] (d) Toothpaste

Assertion: Transparent soaps are made by dissolving soaps in ethanol.

Reason: Ethanol makes things invisible.


Green chemistry in day-to-day life is in the use of ______.


Self-cleansing windows are example of the ______.


Share
Notifications

Englishहिंदीमराठी


      Forgot password?
Use app×