Advertisements
Advertisements
प्रश्न
What is the side product of soap industry? Give reactions showing soap formation.
Advertisements
उत्तर
Glycerol is obtained as a side product during the formation of soaps.
The process of soap formation is referred as saponification. It is the process that involves the conversion of fat or oil into soap and alcohol by action of heat in the presence of aqueous alkali.
\[\begin{array}{cc}
\ce{O}\phantom{..........................................}\\
||\phantom{..........................................}\\
\phantom{.}\ce{CH2 - O - \underset{}{C} - C17H35}\phantom{..................................}\ce{CH2 - OH}\phantom{.}\\
\phantom{..}|\phantom{..........}\ce{O}\phantom{............................................}|\phantom{..........}\\
|\phantom{..........}||\phantom{.....................................................}\\
\phantom{}\ce{CH - O - C - C17H35 + \underset{hydroxide}{\underset{Sodium}{3NaOH}} -> \underset{sterate}{\underset{Sodium}{3C17H35COONa}} + CH - OH}\phantom{.}\\
\phantom{..}|\phantom{..........}\ce{O}\phantom{............................................}|\phantom{..........}\\
|\phantom{..........}||\phantom{.....................................................}\\
\phantom{.}\ce{\underset{of stearic acid (Fat)}{\underset{Glyceryl ester}{CH2 - O - C - C17H35}}\phantom{...................................}\ce{\underset{(or Glycerine)}{\underset{Glycerol}{CH2 - OH}}}\phantom{}}
\end{array}\]
APPEARS IN
संबंधित प्रश्न
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.

Why do soaps not work in hard water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
Why is it safer to use soap from the environmental point of view?
What is the difference between bathing soap and washing soaps?
How are transparent soaps manufactured?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i) ![]() |
(a) Dishwashing powder |
(ii) ![]() |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Transparent soaps are made by dissolving soaps in ethanol.
Reason: Ethanol makes things invisible.
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.


