Advertisements
Advertisements
प्रश्न
How soap is prepared?
Advertisements
उत्तर
Soaps are formed by heating fat or oil (i.e. glyceryl esters of fatty acids) with aqueous sodium hydroxide solution. This reaction is called saponification.
During the process of hydrolysis esters of fatty acids are hydrolyzed and the soap is obtained in the colloidal form. It floats in solution as curd. It is precipited from the solution by adding sodium chloride.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
What is a soap ?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Following type of nom-ionic detergents are present in liquid detergents, emulsifying agents and wetting agents. Label the hydrophilic and hydrophobic parts in the molecule. Identify the functional group (s) present in the molecule.
Why do soaps not work in hard water?
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Which of the following enhances leathering property of soap?
Glycerol is added to soap. It functions ______.
What is a soft soap?
Why is it safer to use soap from the environmental point of view?
How are transparent soaps manufactured?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Green chemistry in day-to-day life is in the use of ______.
Self-cleansing windows are example of the ______.
