Advertisements
Advertisements
प्रश्न
Glycerol is added to soap. It functions ______.
विकल्प
As a filler
To increase leathering.
To prevent rapid drying.
To make soap granules.
Advertisements
उत्तर
Glycerol is added to soap. It functions to prevent rapid drying.
Explanation:
Glycerol is added to shaving soap to prevent rapid drying while to enhance the leathering property of soap, a gum called rosin is added to them. It forms sodium rosinate which lathers well.
APPEARS IN
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Can you use soaps and synthetic detergents to check the hardness of water?
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of methyl bromide on silver propanoate
Which of the following enhances leathering property of soap?
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
Why is it safer to use soap from the environmental point of view?
What is the difference between bathing soap and washing soaps?
What are fillers and what role these fillers play in soap?
Match the soaps given in Column I with items given in Column II.
| Column I | Column II |
| (i) Soap chips | (a) dried miniature soap bubbles |
| (ii) Soap granules | (b) small broken pieces of soap formed from melted soaps |
| (iii) Soap powder | (c) soap powder + abrasives + builders \[\ce{(Na2CO3,Na3PO4)}\] |
| (iv) Scouring soap | (d) soap powder + builders like \[\ce{Na2CO3}\] and \[\ce{Na3PO4}\] |
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Which of the following is not a correct statement?
Self-cleansing windows are example of the ______.
