Advertisements
Advertisements
प्रश्न
Can you use soaps and synthetic detergents to check the hardness of water?
Advertisements
उत्तर १
Soaps get precipitated in hard water, but not in soft water. Therefore, soaps can be used for checking the hardness of water.
However, synthetic detergents do not get precipitated either in hard water or in soft water. Therefore, synthetic detergents cannot be used for checking the hardness of water.
उत्तर २
Soaps get precipitated as insoluble calcium and magnesium soaps in hard water but detergents do not. Therefore, soaps but not synthetic detergents can be used to check the hardness of water.
संबंधित प्रश्न
Explain cationic detergents.
Why is bithional added to soap?
Write the chemical equation for preparing sodium soap from Glyceryl palmitate . Structural formulae of the compounds are given below.
(C15H31COO)3C3H5 – Glyceryl palmitate
Write the chemical equation for preparing sodium soap from glyceryl oleate . Structural formulae of the compounds are given below.
(C17H32COO)3C3H5 – Glyceryl oleate
Explain the cleansing action of soaps.
Explain the mechanism of cleansing action of soaps.
Write balanced chemical equations for the action of hydrogen bromide on styrene in the presence of a peroxide
How soap is prepared?
Glycerol is added to soap. It functions ______.
What is a soft soap?
If soap has high alkali content it irritates skin. How can the amount of excess alkali be determined? What can be the source of excess alkali?
What is the difference between bathing soap and washing soaps?
What are fillers and what role these fillers play in soap?
Match the detergents given in Column I with their uses given in Column II.
| Column I | Column II |
(i)  |
(a) Dishwashing powder |
(ii)  |
(b) Laundry soap |
| (iii) \[\ce{C17H33CO\overset{-}{O}\overset{+}{N}a + Na2CO3 + Rosin}\] | (c) Hair conditioners |
| (iv) \[\ce{CH3(CH2)16COO(CH2CH2O)nCH2CH2OH}\] | (d) Toothpaste |
Assertion: Sodium chloride is added to precipitate soap after saponification.
Reason: Hydrolysis of esters of long-chain fatty acids by alkali produces soap in colloidal form.
Self-cleansing windows are example of the ______.
