Chapters
Chapter 11 - Alcohols, Phenols and Ethers
Chapter 12 - Aldehydes, Ketones and Carboxylic Acids
Chapter 13 - Amines
Chapter 14 - Biomolecules
Chapter 15 - Polymers
Chapter 16 - Chemistry in Everyday Life
Chapter 12 - Aldehydes, Ketones and Carboxylic Acids
Pages 353 - 376
Write the structures of the following compounds
α-Methoxypropionaldehyde
Write the structures of the following compounds.
3-Hydroxybutanal
Write the structures of the following compounds.
2-Hydroxycyclopentane carbaldehyde
Write the structures of the following compounds.
4-Oxopentanal
Write the structures of the following compounds
Di-sec-butyl ketone
Write the structures of the following compounds
4-Fluoroacetophenone
Write the structures of products of the following reactions;
Write the structures of products of the following reactions;
`(C_6H_5CH_2)_2Cd + 2CH_3COCl ->`
Write the structures of products of the following reactions;
Write the structures of products of the following reactions;
Arrange the following compounds in increasing order of their boiling points.
CH3CHO, CH3CH2OH, CH3OCH3, CH3CH2CH3
Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions
Ethanal, Propanal, Propanone, Butanone.
Arrange the following compounds in increasing order of their reactivity in nucleophilic addition reactions.
Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.
Predict the products of the following reactions:
Predict the products of the following reactions
Predict the products of the following reactions:
Predict the products of the following reactions:
Give the IUPAC names of the following compounds:
PhCH2CH2COOH
Give the IUPAC names of the following compounds:
(CH3)2C=CHCOOH
Give the IUPAC names of the following compounds:
Give the IUPAC names of the following compounds:
Show how each of the following compounds can be converted to benzoic acid.
Ethylbenzene
Show how each of the following compounds can be converted to benzoic acid.
Acetophenone
Show how each of the following compounds can be converted to benzoic acid.
Bromobenzene
Show how each of the following compounds can be converted to benzoic acid.
Phenylethene (Styrene)
Which acid of each pair shown here would you expect to be stronger?
CH3CO2H or CH2FCO2H
Which acid of each pair shown here would you expect to be stronger?
CH2FCO2H or CH2ClCO2H
Which acid of each pair shown here would you expect to be stronger?
CH2FCH2CH2CO2H or CH3CHFCH2CO2H
Which acid of each pair shown here would you expect to be stronger?
Pages 377 - 379
What is meant by the following terms? Give an example of the reaction in each case.
Schiff’s base
What is meant by the following terms? Give an example of the reaction in each case.
Cyanohydrin
What is meant by the following terms? Give an example of the reaction in each case.
Acetal
What is meant by the following terms? Give an example of the reaction in each case.
Semicarbazone
What is meant by the following terms? Give an example of the reaction in each case.
Aldol
What is meant by the following terms? Give an example of the reaction in each case.
Hemiacetal
What is meant by the following terms? Give an example of the reaction in each case.
Oxime
What is meant by the following terms? Give an example of the reaction in each case.
Ketal
What is meant by the following terms? Give an example of the reaction in each case.
Imine
What is meant by the following terms? Give an example of the reaction in each case.
2,4-DNP-derivative
Name the following compound according to IUPAC system of nomenclature:
CH3CH(CH3)CH2CH2CHO
Name the following compounds according to IUPAC system of nomenclature
CH3CH2COCH(C2H5)CH2CH2Cl
Name the following compounds according to IUPAC system of nomenclature:
CH3CH=CHCHO
Name the following compounds according to IUPAC system of nomenclature:
CH3COCH2COCH3
Name the following compounds according to IUPAC system of nomenclature:
CH3CH(CH3)CH2C(CH3)2COCH3
Name the following compounds according to IUPAC system of nomenclature:
OHCC6H4CHO-p
Draw the structures of the given compound - 3-Methylbutanal
Draw the structures of the given compound - p-Nitropropiophenone
Write the structure of p-methylbenzaldehyde.
Draw the structures of the given compounds - 4-Methylpent-3-en-2-one
Write the structure of 4-chloropentan-2-one.
Draw the structures of the given compound - 3-Bromo-4-phenylpentanoic acid
Draw the structures of given compounds - p,p’-Dihydroxybenzophenone
Draw the structures of the given compounds - Hex-2-en-4-ynoic acid
Write the IUPAC name of the following ketones and aldehydes. Wherever possible, give also common name.
CH3CO(CH2)4CH3
Write the IUPAC name of the following ketones and aldehydes. Wherever possible, give also common names.
CH3CH2CHBrCH2CH(CH3)CHO
Write the IUPAC names of the following ketones and aldehydes. Wherever possible, give also common names.
CH3(CH2)5CHO
Write the IUPAC name of the following ketones and aldehydes. Wherever possible, give also common name.
Ph-CH=CH-CHO
Write the IUPAC name of the following ketones and aldehydes. Wherever possible, give also common name
Write the IUPAC name of the following ketones and aldehydes. Wherever possible, give also common name.
PhCOPh
Draw structures of the given derivatives - The 2,4-dinitrophenylhydrazone of benzaldehyde
Draw structures of the given derivatives - Cyclopropanone oxime
Draw structures of the given derivatives - Acetaldehydedimethylacetal
Draw structures of given derivatives The semicarbazone of cyclobutanone
Draw structures of the given derivatives The ethylene ketal of hexan-3-one
Draw structures of the given derivatives The methyl hemiacetal of formaldehyde.
Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
PhMgBr and then H3O+
Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
Tollens’ reagent
Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
Semicarbazide and weak acid
Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
Excess ethanol and acid
Predict the products formed when cyclohexanecarbaldehyde reacts with following reagents.
Zinc amalgam and dilute hydrochloric acid
Which of the following compounds would undergo aldol condensation, which the Cannizzaro reaction and which neither? Write the structures of the expected products of aldol condensation and Cannizzaro reaction.
(i) Methanal
(ii) 2-Methylpentanal
(iii) Benzaldehyde
(iv) Benzophenone
(v) Cyclohexanone
(vi) 1-Phenylpropanone
(vii) Phenylacetaldehyde
(viii) Butan-1-ol
(ix) 2, 2-Dimethylbutanal
How will you convert ethanal into the following compounds?
Butane-1, 3-diol
How will you convert ethanal into the following compounds?
But-2-enal
How will you convert ethanal into the following compounds?
But-2-enoic acid
Write structural formulas and names of four possible aldol condensation products from propanal and butanal. In each case, indicate which aldehyde acts as nucleophile and which as electrophile.
An organic compound with the molecular formula C9H10O forms 2, 4-DNP derivative, reduces Tollens’ reagent and undergoes Cannizzaro reaction. On vigorous oxidation, it gives 1, 2-benzenedicarboxylic acid. Identify the compound.
An organic compound (A) (molecular formula C8H16O2) was hydrolysed with dilute sulphuric acid to give a carboxylic acid (B) and an alcohol (C). Oxidation of (C) with chromic acid produced (B). (C) on dehydration gives but-1-ene.Write equations for the reactions involved.
Arrange the following compounds in increasing order of their property as indicated:
Acetaldehyde, Acetone, Di-tert-butyl ketone, Methyl tert-butyl ketone (reactivity towards HCN)
Arrange the following compounds in increasing order of their property as indicated:
CH3CH2CH(Br)COOH, CH3CH(Br)CH2COOH, (CH3)2CHCOOH, CH3CH2CH2COOH (acid strength)
Arrange the following compounds in increasing order of their property as indicated:
Benzoic acid, 4-Nitrobenzoic acid, 3,4-Dinitrobenzoic acid, 4-Methoxybenzoic acid (acid strength)
Give simple chemical tests to distinguish between the following pairs of compounds
Propanal and Propanone
Give simple chemical tests to distinguish between the following pairs of compounds.
Acetophenone and Benzophenone
Give simple chemical tests to distinguish between the following pairs of compounds.
Phenol and Benzoic acid
Give simple chemical tests to distinguish between the following pairs of compounds.
Benzoic acid and Ethyl benzoate
Give simple chemical tests to distinguish between the following pairs of compounds.
Pentan-2-one and Pentan-3-one
Give simple chemical tests to distinguish between the following pairs of compounds.
Benzaldehyde and Acetophenone
Give simple chemical tests to distinguish between the following pairs of compounds:
Ethanal and Propanal
How will you prepare the given compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom
Methyl benzoate
How will you prepare the given compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom
m-Nitrobenzoic acid
How will you prepare the given compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom
p-Nitrobenzoic acid
How will you prepare the given compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom
Phenylacetic acid
How will you prepare the given compounds from benzene? You may use any inorganic reagent and any organic reagent having not more than one carbon atom
How will you bring about the following conversions in not more than two steps?
Propanone to Propene
How will you bring about the following conversions in not more than two steps?
Benzoic acid to Benzaldehyde
How will you bring about the following conversions in not more than two steps?
Ethanol to 3-Hydroxybutanal
How will you bring about the following conversions in not more than two steps?
Benzene to m-Nitroacetophenone
How will you bring about the following conversions in not more than two steps?
Benzaldehyde to Benzophenone
How will you bring about the following conversions in not more than two steps?
Bromobenzene to 1-Phenylethanol
How will you bring about the following conversions in not more than two steps?
Benzaldehyde to 3-Phenylpropan-1-ol
How will you bring about the following conversions in not more than two steps?
Benzoic acid to m- Nitrobenzyl alcohol
How will you bring about the following conversions in not more than two steps?
Benazaldehyde to α-Hydroxyphenylacetic acid
Describe Acetylation
Describe Cannizzaro reaction
Describe Cross aldol condensation
Describe Decarboxylation
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Complete each synthesis by giving missing starting material, reagent or products
Give plausible explanation for each of the following:
Cyclohexanone forms cyanohydrin in good yield but 2, 2, 6 trimethylcyclohexanone does not.
Give plausible explanation for each of the following:
There are two −NH2 groups in semicarbazide. However, only one is involved in the formation of semicarbazones.
Give plausible explanation for each of the following:
During the preparation of esters from a carboxylic acid and an alcohol in the presence of an acid catalyst, the water or the ester should be removed as soon as it is formed.
An organic compound contains 69.77% carbon, 11.63% hydrogen and rest oxygen. The molecular mass of the compound is 86. It does not reduce Tollens’ reagent but forms an addition compound with sodium hydrogensulphite and give positive iodoform test. On vigorous oxidation it gives ethanoic and propanoic acid. Write the possible structure of the compound
Although phenoxide ion has more number of resonating structures than Carboxylate ion, Carboxylic acid is a stronger acid than phenol. Give two reasons.